C23H25N — CID 88551372
(2Z,4E,7Z,9E)-4,9-diphenylundeca-2,4,7,9-tetraen-2-amine (PubChem CID 88551372) has the molecular formula C23H25N and a molecular weight of 315.46 g/mol. Its IUPAC name is (2Z,4E,7Z,9E)-4,9-diphenylundeca-2,4,7,9-tetraen-2-amine.
| Compound Name | (2Z,4E,7Z,9E)-4,9-diphenylundeca-2,4,7,9-tetraen-2-amine |
|---|---|
| PubChem CID | 88551372 |
| Molecular Formula | C23H25N |
| Molecular Weight | 315.46 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | (2Z,4E,7Z,9E)-4,9-diphenylundeca-2,4,7,9-tetraen-2-amine |
| SMILES | C/C=C(\C=C/C/C=C(\C=C(\C)N)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H25N/c1-3-20(21-13-6-4-7-14-21)12-10-11-17-23(18-19(2)24)22-15-8-5-9-16-22/h3-10,12-18H,11,24H2,1-2H3/b12-10-,19-18-,20-3+,23-17+ |
| InChIKey | YGRHLSUNYDWYLO-NTHMPLPQSA-N |
| XLogP | 5.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.46 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|