About methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate
methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate (PubChem CID 88551522) has the molecular formula C16H26O2
and a molecular weight of 250.38 g/mol. Its IUPAC name is methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate.
Molecular Properties
| Compound Name | methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate |
| PubChem CID | 88551522 |
| Molecular Formula | C16H26O2 |
| Molecular Weight | 250.38 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate |
| SMILES | C=C(CCC=C(C)C)CC/C=C(\C)CC(=O)OC |
| InChI | InChI=1S/C16H26O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h8,11H,3,6-7,9-10,12H2,1-2,4-5H3/b15-11+ |
| InChIKey | JHURPBGVIZWTOW-RVDMUPIBSA-N |
| XLogP | 4.58 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.38 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate?
The IUPAC name of methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate (CID 88551522) is methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate.
What is the SMILES notation for methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate?
The canonical SMILES for methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate is C=C(CCC=C(C)C)CC/C=C(\C)CC(=O)OC.
What is the InChIKey of methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate?
The InChIKey is JHURPBGVIZWTOW-RVDMUPIBSA-N. The full InChI is InChI=1S/C16H26O2/c1-13(2)8-6-9-14(3)10-7-11-15(4)12-16(17)18-5/h8,11H,3,6-7,9-10,12H2,1-2,4-5H3/b15-11+.
What are the key properties of methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate?
methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate has a molecular weight of 250.38 g/mol, XLogP of 4.58, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (3E)-3,11-dimethyl-7-methylidenedodeca-3,10-dienoate is sourced from PubChem (CID 88551522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).