C17H22O8S — CID 88551635
methyl (3R,4S,5R)-3-acetyloxy-4-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate (PubChem CID 88551635) has the molecular formula C17H22O8S and a molecular weight of 386.42 g/mol. Its IUPAC name is methyl (3R,4S,5R)-3-acetyloxy-4-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate.
| Compound Name | methyl (3R,4S,5R)-3-acetyloxy-4-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 88551635 |
| Molecular Formula | C17H22O8S |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | methyl (3R,4S,5R)-3-acetyloxy-4-hydroxy-5-(4-methylphenyl)sulfonyloxycyclohexane-1-carboxylate |
| SMILES | COC(=O)C1C[C@@H](OC(C)=O)[C@H](O)[C@H](OS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C17H22O8S/c1-10-4-6-13(7-5-10)26(21,22)25-15-9-12(17(20)23-3)8-14(16(15)19)24-11(2)18/h4-7,12,14-16,19H,8-9H2,1-3H3/t12?,14-,15-,16+/m1/s1 |
| InChIKey | REXPDXANDCKJFG-SJFVDLKVSA-N |
| XLogP | 0.94 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|