About 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol
2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol (PubChem CID 88551652) has the molecular formula C13H24OS
and a molecular weight of 228.40 g/mol. Its IUPAC name is 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol.
Molecular Properties
| Compound Name | 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol |
| PubChem CID | 88551652 |
| Molecular Formula | C13H24OS |
| Molecular Weight | 228.40 g/mol |
| Exact Mass | 228.15 |
| IUPAC Name | 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol |
| SMILES | C=C(/C=C/CCCCCCC)OCCS |
| InChI | InChI=1S/C13H24OS/c1-3-4-5-6-7-8-9-10-13(2)14-11-12-15/h9-10,15H,2-8,11-12H2,1H3/b10-9+ |
| InChIKey | QGHKCVSHNOOLNV-MDZDMXLPSA-N |
| XLogP | 4.36 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.40 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol?
The IUPAC name of 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol (CID 88551652) is 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol.
What is the SMILES notation for 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol?
The canonical SMILES for 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol is C=C(/C=C/CCCCCCC)OCCS.
What is the InChIKey of 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol?
The InChIKey is QGHKCVSHNOOLNV-MDZDMXLPSA-N. The full InChI is InChI=1S/C13H24OS/c1-3-4-5-6-7-8-9-10-13(2)14-11-12-15/h9-10,15H,2-8,11-12H2,1H3/b10-9+.
What are the key properties of 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol?
2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol has a molecular weight of 228.40 g/mol, XLogP of 4.36, 10 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3E)-undeca-1,3-dien-2-yl]oxyethanethiol is sourced from PubChem (CID 88551652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).