About 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine
1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine (PubChem CID 88551762) has the molecular formula C35H33NO2P2
and a molecular weight of 561.60 g/mol. Its IUPAC name is 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine.
Molecular Properties
| Compound Name | 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine |
| PubChem CID | 88551762 |
| Molecular Formula | C35H33NO2P2 |
| Molecular Weight | 561.60 g/mol |
| Exact Mass | 561.20 |
| IUPAC Name | 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine |
| SMILES | O=P(c1ccccc1)(c1ccccc1)C1CN(Cc2ccccc2)CC1P(=O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C35H33NO2P2/c37-39(30-18-8-2-9-19-30,31-20-10-3-11-21-31)34-27-36(26-29-16-6-1-7-17-29)28-35(34)40(38,32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-25,34-35H,26-28H2 |
| InChIKey | FLQRZTWLYFVZAJ-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 561.60 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine?
The IUPAC name of 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine (CID 88551762) is 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine.
What is the SMILES notation for 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine?
The canonical SMILES for 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine is O=P(c1ccccc1)(c1ccccc1)C1CN(Cc2ccccc2)CC1P(=O)(c1ccccc1)c1ccccc1.
What is the InChIKey of 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine?
The InChIKey is FLQRZTWLYFVZAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H33NO2P2/c37-39(30-18-8-2-9-19-30,31-20-10-3-11-21-31)34-27-36(26-29-16-6-1-7-17-29)28-35(34)40(38,32-22-12-4-13-23-32)33-24-14-5-15-25-33/h1-25,34-35H,26-28H2.
What are the key properties of 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine?
1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine has a molecular weight of 561.60 g/mol, XLogP of 6.27, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-3,4-bis(diphenylphosphoryl)pyrrolidine is sourced from PubChem (CID 88551762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).