C22H40O4Si — CID 88552315
(3aR,4S,5R,6aS)-4-[8-[tert-butyl(dimethyl)silyl]oxy-5,5,6,6,7,7-hexadeuterio-3-oxooctyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 88552315) has the molecular formula C22H40O4Si and a molecular weight of 402.68 g/mol. Its IUPAC name is (3aR,4S,5R,6aS)-4-[8-[tert-butyl(dimethyl)silyl]oxy-5,5,6,6,7,7-hexadeuterio-3-oxooctyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aR,4S,5R,6aS)-4-[8-[tert-butyl(dimethyl)silyl]oxy-5,5,6,6,7,7-hexadeuterio-3-oxooctyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 88552315 |
| Molecular Formula | C22H40O4Si |
| Molecular Weight | 402.68 g/mol |
| Exact Mass | 402.31 |
| IUPAC Name | (3aR,4S,5R,6aS)-4-[8-[tert-butyl(dimethyl)silyl]oxy-5,5,6,6,7,7-hexadeuterio-3-oxooctyl]-5-methyl-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | [2H]C([2H])(CO[Si](C)(C)C(C)(C)C)C([2H])([2H])C([2H])([2H])CC(=O)CC[C@@H]1[C@H]2CC(=O)O[C@H]2C[C@H]1C |
| InChI | InChI=1S/C22H40O4Si/c1-16-14-20-19(15-21(24)26-20)18(16)12-11-17(23)10-8-7-9-13-25-27(5,6)22(2,3)4/h16,18-20H,7-15H2,1-6H3/t16-,18+,19-,20+/m1/s1/i7D2,8D2,9D2 |
| InChIKey | QFPVJURJZGHQRR-XXMBSZIJSA-N |
| XLogP | 5.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.68 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|