C21H34F10O6 — CID 88552328
2-[[3-[2-(hydroxymethyl)-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propan-1-ol (PubChem CID 88552328) has the molecular formula C21H34F10O6 and a molecular weight of 572.48 g/mol. Its IUPAC name is 2-[[3-[2-(hydroxymethyl)-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propan-1-ol.
| Compound Name | 2-[[3-[2-(hydroxymethyl)-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propan-1-ol |
|---|---|
| PubChem CID | 88552328 |
| Molecular Formula | C21H34F10O6 |
| Molecular Weight | 572.48 g/mol |
| Exact Mass | 572.22 |
| IUPAC Name | 2-[[3-[2-(hydroxymethyl)-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propoxy]-2,2-dimethylpropoxy]methyl]-2-methyl-3-(2,2,3,3,3-pentafluoropropoxy)propan-1-ol |
| SMILES | CC(C)(COCC(C)(CO)COCC(F)(F)C(F)(F)F)COCC(C)(CO)COCC(F)(F)C(F)(F)F |
| InChI | InChI=1S/C21H34F10O6/c1-15(2,7-34-9-16(3,5-32)11-36-13-18(22,23)20(26,27)28)8-35-10-17(4,6-33)12-37-14-19(24,25)21(29,30)31/h32-33H,5-14H2,1-4H3 |
| InChIKey | WHBWZYPUAMWGBT-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|