C36H26F6N2 — CID 88552409
2-(11-methyl-12-phenyl-12-pyridin-2-ylindeno[2,1-a]fluoren-11-yl)-N,N-bis(trifluoromethyl)ethanamine (PubChem CID 88552409) has the molecular formula C36H26F6N2 and a molecular weight of 600.61 g/mol. Its IUPAC name is 2-(11-methyl-12-phenyl-12-pyridin-2-ylindeno[2,1-a]fluoren-11-yl)-N,N-bis(trifluoromethyl)ethanamine.
| Compound Name | 2-(11-methyl-12-phenyl-12-pyridin-2-ylindeno[2,1-a]fluoren-11-yl)-N,N-bis(trifluoromethyl)ethanamine |
|---|---|
| PubChem CID | 88552409 |
| Molecular Formula | C36H26F6N2 |
| Molecular Weight | 600.61 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | 2-(11-methyl-12-phenyl-12-pyridin-2-ylindeno[2,1-a]fluoren-11-yl)-N,N-bis(trifluoromethyl)ethanamine |
| SMILES | CC1(CCN(C(F)(F)F)C(F)(F)F)c2ccccc2-c2ccc3c(c21)C(c1ccccc1)(c1ccccn1)c1ccccc1-3 |
| InChI | InChI=1S/C36H26F6N2/c1-33(20-22-44(35(37,38)39)36(40,41)42)28-15-7-5-13-24(28)26-18-19-27-25-14-6-8-16-29(25)34(32(27)31(26)33,23-11-3-2-4-12-23)30-17-9-10-21-43-30/h2-19,21H,20,22H2,1H3 |
| InChIKey | KGJVUMJJFMBRKD-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.61 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|