C39H36B2F6O6 — CID 88552421
2-[7-(1,3,2-dioxaborolan-2-yl)-2',7'-bis[4-(trifluoromethoxy)butyl]-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane (PubChem CID 88552421) has the molecular formula C39H36B2F6O6 and a molecular weight of 736.32 g/mol. Its IUPAC name is 2-[7-(1,3,2-dioxaborolan-2-yl)-2',7'-bis[4-(trifluoromethoxy)butyl]-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 2-[7-(1,3,2-dioxaborolan-2-yl)-2',7'-bis[4-(trifluoromethoxy)butyl]-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 88552421 |
| Molecular Formula | C39H36B2F6O6 |
| Molecular Weight | 736.32 g/mol |
| Exact Mass | 736.26 |
| IUPAC Name | 2-[7-(1,3,2-dioxaborolan-2-yl)-2',7'-bis[4-(trifluoromethoxy)butyl]-9,9'-spirobi[fluorene]-2-yl]-1,3,2-dioxaborolane |
| SMILES | FC(F)(F)OCCCCc1ccc2c(c1)C1(c3cc(CCCCOC(F)(F)F)ccc3-2)c2cc(B3OCCO3)ccc2-c2ccc(B3OCCO3)cc21 |
| InChI | InChI=1S/C39H36B2F6O6/c42-38(43,44)48-15-3-1-5-25-7-11-29-30-12-8-26(6-2-4-16-49-39(45,46)47)22-34(30)37(33(29)21-25)35-23-27(40-50-17-18-51-40)9-13-31(35)32-14-10-28(24-36(32)37)41-52-19-20-53-41/h7-14,21-24H,1-6,15-20H2 |
| InChIKey | GIHRQTPXYRCNPA-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.32 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|