C26H26F6O — CID 88552480
2-but-3-enyl-5-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)oxane (PubChem CID 88552480) has the molecular formula C26H26F6O and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-but-3-enyl-5-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)oxane.
| Compound Name | 2-but-3-enyl-5-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)oxane |
|---|---|
| PubChem CID | 88552480 |
| Molecular Formula | C26H26F6O |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | 2-but-3-enyl-5-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)oxane |
| SMILES | C=CCCC1CCC(c2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)CO1 |
| InChI | InChI=1S/C26H26F6O/c1-3-5-7-17-10-8-16(14-33-17)18-12-13-20-19-11-9-15(6-4-2)23(27)21(19)25(29,30)26(31,32)22(20)24(18)28/h3,9,11-13,16-17H,1,4-8,10,14H2,2H3 |
| InChIKey | YETKXEHZLXAVSD-UHFFFAOYSA-N |
| XLogP | 8.01 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|