C27H28F6O2 — CID 88552510
5-but-3-enyl-2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-1,3-dioxane (PubChem CID 88552510) has the molecular formula C27H28F6O2 and a molecular weight of 498.51 g/mol. Its IUPAC name is 5-but-3-enyl-2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-1,3-dioxane.
| Compound Name | 5-but-3-enyl-2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-1,3-dioxane |
|---|---|
| PubChem CID | 88552510 |
| Molecular Formula | C27H28F6O2 |
| Molecular Weight | 498.51 g/mol |
| Exact Mass | 498.20 |
| IUPAC Name | 5-but-3-enyl-2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-1,3-dioxane |
| SMILES | C=CCCC1COC(CCc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)OC1 |
| InChI | InChI=1S/C27H28F6O2/c1-3-5-7-16-14-34-21(35-15-16)13-10-18-9-12-20-19-11-8-17(6-4-2)24(28)22(19)26(30,31)27(32,33)23(20)25(18)29/h3,8-9,11-12,16,21H,1,4-7,10,13-15H2,2H3 |
| InChIKey | GQPCBIWKCOQXQS-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.51 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|