C28H32F6O2 — CID 88552515
2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-5-pentyl-1,3-dioxane (PubChem CID 88552515) has the molecular formula C28H32F6O2 and a molecular weight of 514.55 g/mol. Its IUPAC name is 2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-5-pentyl-1,3-dioxane.
| Compound Name | 2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-5-pentyl-1,3-dioxane |
|---|---|
| PubChem CID | 88552515 |
| Molecular Formula | C28H32F6O2 |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | 2-[2-(1,8,9,9,10,10-hexafluoro-7-propylphenanthren-2-yl)ethyl]-5-pentyl-1,3-dioxane |
| SMILES | CCCCCC1COC(CCc2ccc3c(c2F)C(F)(F)C(F)(F)c2c-3ccc(CCC)c2F)OC1 |
| InChI | InChI=1S/C28H32F6O2/c1-3-5-6-8-17-15-35-22(36-16-17)14-11-19-10-13-21-20-12-9-18(7-4-2)25(29)23(20)27(31,32)28(33,34)24(21)26(19)30/h9-10,12-13,17,22H,3-8,11,14-16H2,1-2H3 |
| InChIKey | VVQXKHJWZLBRTE-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|