About (2E,3Z)-2,3-di(ethylidene)pyridine
(2E,3Z)-2,3-di(ethylidene)pyridine (PubChem CID 88552849) has the molecular formula C9H11N
and a molecular weight of 133.19 g/mol. Its IUPAC name is (2E,3Z)-2,3-di(ethylidene)pyridine.
Molecular Properties
| Compound Name | (2E,3Z)-2,3-di(ethylidene)pyridine |
| PubChem CID | 88552849 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | (2E,3Z)-2,3-di(ethylidene)pyridine |
| SMILES | C/C=c1/cccn/c1=C/C |
| InChI | InChI=1S/C9H11N/c1-3-8-6-5-7-10-9(8)4-2/h3-7H,1-2H3/b8-3-,9-4+ |
| InChIKey | JHMQCDLDHLNPAC-SNXNNQDSSA-N |
| XLogP | 0.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2E,3Z)-2,3-di(ethylidene)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,3Z)-2,3-di(ethylidene)pyridine?
The IUPAC name of (2E,3Z)-2,3-di(ethylidene)pyridine (CID 88552849) is (2E,3Z)-2,3-di(ethylidene)pyridine.
What is the SMILES notation for (2E,3Z)-2,3-di(ethylidene)pyridine?
The canonical SMILES for (2E,3Z)-2,3-di(ethylidene)pyridine is C/C=c1/cccn/c1=C/C.
What is the InChIKey of (2E,3Z)-2,3-di(ethylidene)pyridine?
The InChIKey is JHMQCDLDHLNPAC-SNXNNQDSSA-N. The full InChI is InChI=1S/C9H11N/c1-3-8-6-5-7-10-9(8)4-2/h3-7H,1-2H3/b8-3-,9-4+.
What are the key properties of (2E,3Z)-2,3-di(ethylidene)pyridine?
(2E,3Z)-2,3-di(ethylidene)pyridine has a molecular weight of 133.19 g/mol, XLogP of 0.68, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,3Z)-2,3-di(ethylidene)pyridine is sourced from PubChem (CID 88552849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).