C34H21F10O2S+ — CID 88553199
(4-tert-butylphenyl)-bis[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]sulfanium (PubChem CID 88553199) has the molecular formula C34H21F10O2S+ and a molecular weight of 683.59 g/mol. Its IUPAC name is (4-tert-butylphenyl)-bis[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]sulfanium.
| Compound Name | (4-tert-butylphenyl)-bis[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]sulfanium |
|---|---|
| PubChem CID | 88553199 |
| Molecular Formula | C34H21F10O2S+ |
| Molecular Weight | 683.59 g/mol |
| Exact Mass | 683.11 |
| IUPAC Name | (4-tert-butylphenyl)-bis[4-(2,3,4,5,6-pentafluorophenoxy)phenyl]sulfanium |
| SMILES | CC(C)(C)c1ccc([S+](c2ccc(Oc3c(F)c(F)c(F)c(F)c3F)cc2)c2ccc(Oc3c(F)c(F)c(F)c(F)c3F)cc2)cc1 |
| InChI | InChI=1S/C34H21F10O2S/c1-34(2,3)16-4-10-19(11-5-16)47(20-12-6-17(7-13-20)45-32-28(41)24(37)22(35)25(38)29(32)42)21-14-8-18(9-15-21)46-33-30(43)26(39)23(36)27(40)31(33)44/h4-15H,1-3H3/q+1 |
| InChIKey | XKDOVNQZKQPBEF-UHFFFAOYSA-N |
| XLogP | 11.06 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.59 |
| LogP ≤ 5 | 11.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|