C22H18F3OS+ — CID 88553202
5-[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]dibenzothiophen-5-ium (PubChem CID 88553202) has the molecular formula C22H18F3OS+ and a molecular weight of 387.45 g/mol. Its IUPAC name is 5-[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]dibenzothiophen-5-ium.
| Compound Name | 5-[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]dibenzothiophen-5-ium |
|---|---|
| PubChem CID | 88553202 |
| Molecular Formula | C22H18F3OS+ |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 5-[3,5-dimethyl-4-(2,2,2-trifluoroethoxy)phenyl]dibenzothiophen-5-ium |
| SMILES | Cc1cc(-[s+]2c3ccccc3c3ccccc32)cc(C)c1OCC(F)(F)F |
| InChI | InChI=1S/C22H18F3OS/c1-14-11-16(12-15(2)21(14)26-13-22(23,24)25)27-19-9-5-3-7-17(19)18-8-4-6-10-20(18)27/h3-12H,13H2,1-2H3/q+1 |
| InChIKey | BGCOVUVRDNGGIF-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|