C9H9F11O — CID 88553226
2,3,3,4,5,5-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)hexane (PubChem CID 88553226) has the molecular formula C9H9F11O and a molecular weight of 342.15 g/mol. Its IUPAC name is 2,3,3,4,5,5-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)hexane.
| Compound Name | 2,3,3,4,5,5-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)hexane |
|---|---|
| PubChem CID | 88553226 |
| Molecular Formula | C9H9F11O |
| Molecular Weight | 342.15 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2,3,3,4,5,5-hexafluoro-2-(1,1,3,3,3-pentafluoropropoxy)hexane |
| SMILES | CC(F)(F)C(F)C(F)(F)C(C)(F)OC(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C9H9F11O/c1-5(11,12)4(10)9(19,20)6(2,13)21-8(17,18)3-7(14,15)16/h4H,3H2,1-2H3 |
| InChIKey | INAWXPZQAUQULO-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.15 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |