C18H20O2 — CID 88553324
1-(4,6-dimethyloxan-2-yl)-3-methyldeca-3,4,5,6,7,8,9-heptaen-2-one (PubChem CID 88553324) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(4,6-dimethyloxan-2-yl)-3-methyldeca-3,4,5,6,7,8,9-heptaen-2-one.
| Compound Name | 1-(4,6-dimethyloxan-2-yl)-3-methyldeca-3,4,5,6,7,8,9-heptaen-2-one |
|---|---|
| PubChem CID | 88553324 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 1-(4,6-dimethyloxan-2-yl)-3-methyldeca-3,4,5,6,7,8,9-heptaen-2-one |
| SMILES | C=C=C=C=C=C=C=C(C)C(=O)CC1CC(C)CC(C)O1 |
| InChI | InChI=1S/C18H20O2/c1-5-6-7-8-9-10-15(3)18(19)13-17-12-14(2)11-16(4)20-17/h14,16-17H,1,11-13H2,2-4H3 |
| InChIKey | MPPLIJWIVYXSBU-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|