C12H18I2 — CID 88553401
(2E,4E,6E)-1,9-diiodo-3,5,7-trimethylnona-2,4,6-triene (PubChem CID 88553401) has the molecular formula C12H18I2 and a molecular weight of 416.08 g/mol. Its IUPAC name is (2E,4E,6E)-1,9-diiodo-3,5,7-trimethylnona-2,4,6-triene.
| Compound Name | (2E,4E,6E)-1,9-diiodo-3,5,7-trimethylnona-2,4,6-triene |
|---|---|
| PubChem CID | 88553401 |
| Molecular Formula | C12H18I2 |
| Molecular Weight | 416.08 g/mol |
| Exact Mass | 415.95 |
| IUPAC Name | (2E,4E,6E)-1,9-diiodo-3,5,7-trimethylnona-2,4,6-triene |
| SMILES | CC(=C\CI)/C=C(C)/C=C(\C)CCI |
| InChI | InChI=1S/C12H18I2/c1-10(4-6-13)8-12(3)9-11(2)5-7-14/h4,8-9H,5-7H2,1-3H3/b10-4+,11-9+,12-8+ |
| InChIKey | XSLLIUAYAJHXAK-ULJJCYQOSA-N |
| XLogP | 5.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.08 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|