C18H21FN4O3 — CID 88553727
(2S)-7-fluoro-11-[(E)-hydroxyiminomethyl]-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one (PubChem CID 88553727) has the molecular formula C18H21FN4O3 and a molecular weight of 360.39 g/mol. Its IUPAC name is (2S)-7-fluoro-11-[(E)-hydroxyiminomethyl]-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one.
| Compound Name | (2S)-7-fluoro-11-[(E)-hydroxyiminomethyl]-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
|---|---|
| PubChem CID | 88553727 |
| Molecular Formula | C18H21FN4O3 |
| Molecular Weight | 360.39 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | (2S)-7-fluoro-11-[(E)-hydroxyiminomethyl]-2-methyl-6-(4-methylpiperazin-1-yl)-4-oxa-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraen-10-one |
| SMILES | C[C@H]1COc2c(N3CCN(C)CC3)c(F)cc3c(=O)c(/C=N/O)cn1c23 |
| InChI | InChI=1S/C18H21FN4O3/c1-11-10-26-18-15-13(17(24)12(8-20-25)9-23(11)15)7-14(19)16(18)22-5-3-21(2)4-6-22/h7-9,11,25H,3-6,10H2,1-2H3/b20-8+/t11-/m0/s1 |
| InChIKey | WHYIAQFXMYCJGV-FEQLDZPWSA-N |
| XLogP | 1.65 |
| TPSA | 70.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|