C70H42N8 — CID 88554032
2,7,9-triphenyl-4-[6-[6-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)-2-pyridinyl]-2-pyridinyl]-1,10-phenanthroline-3-carbonitrile (PubChem CID 88554032) has the molecular formula C70H42N8 and a molecular weight of 995.16 g/mol. Its IUPAC name is 2,7,9-triphenyl-4-[6-[6-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)-2-pyridinyl]-2-pyridinyl]-1,10-phenanthroline-3-carbonitrile.
| Compound Name | 2,7,9-triphenyl-4-[6-[6-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)-2-pyridinyl]-2-pyridinyl]-1,10-phenanthroline-3-carbonitrile |
|---|---|
| PubChem CID | 88554032 |
| Molecular Formula | C70H42N8 |
| Molecular Weight | 995.16 g/mol |
| Exact Mass | 994.35 |
| IUPAC Name | 2,7,9-triphenyl-4-[6-[6-(2,7,9-triphenylpyrido[3,2-h]quinazolin-4-yl)-2-pyridinyl]-2-pyridinyl]-1,10-phenanthroline-3-carbonitrile |
| SMILES | N#Cc1c(-c2ccccc2)nc2c(ccc3c(-c4ccccc4)cc(-c4ccccc4)nc32)c1-c1cccc(-c2cccc(-c3nc(-c4ccccc4)nc4c3ccc3c(-c5ccccc5)cc(-c5ccccc5)nc34)n2)n1 |
| InChI | InChI=1S/C70H42N8/c71-43-56-63(52-39-37-50-54(44-21-7-1-8-22-44)41-61(46-25-11-3-12-26-46)74-66(50)68(52)76-64(56)48-29-15-5-16-30-48)59-35-19-33-57(72-59)58-34-20-36-60(73-58)65-53-40-38-51-55(45-23-9-2-10-24-45)42-62(47-27-13-4-14-28-47)75-67(51)69(53)78-70(77-65)49-31-17-6-18-32-49/h1-42H |
| InChIKey | YTJYNPCSWVYRHW-UHFFFAOYSA-N |
| XLogP | 16.94 |
| TPSA | 114.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 995.16 |
| LogP ≤ 5 | 16.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|