C18H18N2O2 — CID 88554222
2,3,6,7,8a,8b-hexamethylfuro[3,2-g][1]benzofuran-4,5-dicarbonitrile (PubChem CID 88554222) has the molecular formula C18H18N2O2 and a molecular weight of 294.35 g/mol. Its IUPAC name is 2,3,6,7,8a,8b-hexamethylfuro[3,2-g][1]benzofuran-4,5-dicarbonitrile.
| Compound Name | 2,3,6,7,8a,8b-hexamethylfuro[3,2-g][1]benzofuran-4,5-dicarbonitrile |
|---|---|
| PubChem CID | 88554222 |
| Molecular Formula | C18H18N2O2 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 2,3,6,7,8a,8b-hexamethylfuro[3,2-g][1]benzofuran-4,5-dicarbonitrile |
| SMILES | CC1=C(C)C2=C(C#N)C(C#N)=C3C(C)=C(C)OC3(C)C2(C)O1 |
| InChI | InChI=1S/C18H18N2O2/c1-9-11(3)21-17(5)15(9)13(7-19)14(8-20)16-10(2)12(4)22-18(16,17)6/h1-6H3 |
| InChIKey | XRMWITQEXQCYJL-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 66.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |