C19H21NO — CID 8855432
N-[(1R)-1-cyclopropylethyl]-2,2-diphenylacetamide (PubChem CID 8855432) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is N-[(1R)-1-cyclopropylethyl]-2,2-diphenylacetamide.
| Compound Name | N-[(1R)-1-cyclopropylethyl]-2,2-diphenylacetamide |
|---|---|
| PubChem CID | 8855432 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | N-[(1R)-1-cyclopropylethyl]-2,2-diphenylacetamide |
| SMILES | C[C@@H](NC(=O)C(c1ccccc1)c1ccccc1)C1CC1 |
| InChI | InChI=1S/C19H21NO/c1-14(15-12-13-15)20-19(21)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14-15,18H,12-13H2,1H3,(H,20,21)/t14-/m1/s1 |
| InChIKey | PTFNCIJVHLEWIX-CQSZACIVSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |