C43H35N — CID 88554674
(1E,3Z)-3-methyl-2-[4-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]phenyl]hexa-1,3-dien-1-amine (PubChem CID 88554674) has the molecular formula C43H35N and a molecular weight of 565.76 g/mol. Its IUPAC name is (1E,3Z)-3-methyl-2-[4-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]phenyl]hexa-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-3-methyl-2-[4-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]phenyl]hexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 88554674 |
| Molecular Formula | C43H35N |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.28 |
| IUPAC Name | (1E,3Z)-3-methyl-2-[4-[4-(10-naphthalen-2-ylanthracen-9-yl)phenyl]phenyl]hexa-1,3-dien-1-amine |
| SMILES | CC/C=C(C)\C(=C/N)c1ccc(-c2ccc(-c3c4ccccc4c(-c4ccc5ccccc5c4)c4ccccc34)cc2)cc1 |
| InChI | InChI=1S/C43H35N/c1-3-10-29(2)41(28-44)33-22-17-31(18-23-33)32-19-24-34(25-20-32)42-37-13-6-8-15-39(37)43(40-16-9-7-14-38(40)42)36-26-21-30-11-4-5-12-35(30)27-36/h4-28H,3,44H2,1-2H3/b29-10-,41-28+ |
| InChIKey | OUSSVQSNUMWIST-FZDMJJBYSA-N |
| XLogP | 11.80 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 11.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|