About (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine
(3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine (PubChem CID 88555257) has the molecular formula C12H23NS
and a molecular weight of 213.39 g/mol. Its IUPAC name is (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine.
Molecular Properties
| Compound Name | (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine |
| PubChem CID | 88555257 |
| Molecular Formula | C12H23NS |
| Molecular Weight | 213.39 g/mol |
| Exact Mass | 213.16 |
| IUPAC Name | (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine |
| SMILES | C=C(C(=C)[C@@H](N)CCSC)C(C)CC |
| InChI | InChI=1S/C12H23NS/c1-6-9(2)10(3)11(4)12(13)7-8-14-5/h9,12H,3-4,6-8,13H2,1-2,5H3/t9?,12-/m0/s1 |
| InChIKey | QGZSPZSFHQSEBH-ACGXKRRESA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine?
The IUPAC name of (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine (CID 88555257) is (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine.
What is the SMILES notation for (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine?
The canonical SMILES for (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine is C=C(C(=C)[C@@H](N)CCSC)C(C)CC.
What is the InChIKey of (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine?
The InChIKey is QGZSPZSFHQSEBH-ACGXKRRESA-N. The full InChI is InChI=1S/C12H23NS/c1-6-9(2)10(3)11(4)12(13)7-8-14-5/h9,12H,3-4,6-8,13H2,1-2,5H3/t9?,12-/m0/s1.
What are the key properties of (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine?
(3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine has a molecular weight of 213.39 g/mol, XLogP of 3.23, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-6-methyl-4,5-dimethylidene-1-methylsulfanyloctan-3-amine is sourced from PubChem (CID 88555257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).