C16H24INO4 — CID 88555835
methyl 3-[(2S,3aS,7aS)-3a-(iodomethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate (PubChem CID 88555835) has the molecular formula C16H24INO4 and a molecular weight of 421.28 g/mol. Its IUPAC name is methyl 3-[(2S,3aS,7aS)-3a-(iodomethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate.
| Compound Name | methyl 3-[(2S,3aS,7aS)-3a-(iodomethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate |
|---|---|
| PubChem CID | 88555835 |
| Molecular Formula | C16H24INO4 |
| Molecular Weight | 421.28 g/mol |
| Exact Mass | 421.08 |
| IUPAC Name | methyl 3-[(2S,3aS,7aS)-3a-(iodomethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]propanoate |
| SMILES | [C-]#[N+][C@H](C)CC1CC[C@@H]2O[C@@H](CCC(=O)OC)C[C@]2(CI)O1 |
| InChI | InChI=1S/C16H24INO4/c1-11(18-2)8-12-4-6-14-16(10-17,22-12)9-13(21-14)5-7-15(19)20-3/h11-14H,4-10H2,1,3H3/t11-,12?,13+,14+,16-/m1/s1 |
| InChIKey | AZVGCLFSZFOGKJ-YFOHIPMMSA-N |
| XLogP | 3.15 |
| TPSA | 49.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.28 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|