C15H23NO3 — CID 88555846
[(2R,3aR,7aS)-5-[(2R)-2-isocyanopropyl]-2-[(E)-prop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol (PubChem CID 88555846) has the molecular formula C15H23NO3 and a molecular weight of 265.35 g/mol. Its IUPAC name is [(2R,3aR,7aS)-5-[(2R)-2-isocyanopropyl]-2-[(E)-prop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol.
| Compound Name | [(2R,3aR,7aS)-5-[(2R)-2-isocyanopropyl]-2-[(E)-prop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol |
|---|---|
| PubChem CID | 88555846 |
| Molecular Formula | C15H23NO3 |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.17 |
| IUPAC Name | [(2R,3aR,7aS)-5-[(2R)-2-isocyanopropyl]-2-[(E)-prop-1-enyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-3a-yl]methanol |
| SMILES | [C-]#[N+][C@H](C)CC1CC[C@@H]2O[C@@H](/C=C/C)C[C@]2(CO)O1 |
| InChI | InChI=1S/C15H23NO3/c1-4-5-13-9-15(10-17)14(18-13)7-6-12(19-15)8-11(2)16-3/h4-5,11-14,17H,6-10H2,1-2H3/b5-4+/t11-,12?,13+,14+,15-/m1/s1 |
| InChIKey | QQHJUMMHOZKTPT-DSQHUOBTSA-N |
| XLogP | 2.33 |
| TPSA | 43.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|