C14H23NO5 — CID 88555854
(1R)-1-[(2R,3aR,7aS)-3a-(hydroxymethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol (PubChem CID 88555854) has the molecular formula C14H23NO5 and a molecular weight of 285.34 g/mol. Its IUPAC name is (1R)-1-[(2R,3aR,7aS)-3a-(hydroxymethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol.
| Compound Name | (1R)-1-[(2R,3aR,7aS)-3a-(hydroxymethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 88555854 |
| Molecular Formula | C14H23NO5 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | (1R)-1-[(2R,3aR,7aS)-3a-(hydroxymethyl)-5-[(2R)-2-isocyanopropyl]-2,3,5,6,7,7a-hexahydrofuro[3,2-b]pyran-2-yl]ethane-1,2-diol |
| SMILES | [C-]#[N+][C@H](C)CC1CC[C@@H]2O[C@@H]([C@H](O)CO)C[C@]2(CO)O1 |
| InChI | InChI=1S/C14H23NO5/c1-9(15-2)5-10-3-4-13-14(8-17,20-10)6-12(19-13)11(18)7-16/h9-13,16-18H,3-8H2,1H3/t9-,10?,11-,12-,13+,14-/m1/s1 |
| InChIKey | KMCHKTLVOAUMKD-JPMLEIIKSA-N |
| XLogP | 0.11 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|