C17H24F3NO8S — CID 88555859
methyl 3-[(2S,3R,5R,7aS)-5-[(2R)-2-isocyanopropyl]-3-(trifluoromethylsulfonyloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]propaneperoxoate (PubChem CID 88555859) has the molecular formula C17H24F3NO8S and a molecular weight of 459.44 g/mol. Its IUPAC name is methyl 3-[(2S,3R,5R,7aS)-5-[(2R)-2-isocyanopropyl]-3-(trifluoromethylsulfonyloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]propaneperoxoate.
| Compound Name | methyl 3-[(2S,3R,5R,7aS)-5-[(2R)-2-isocyanopropyl]-3-(trifluoromethylsulfonyloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]propaneperoxoate |
|---|---|
| PubChem CID | 88555859 |
| Molecular Formula | C17H24F3NO8S |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 459.12 |
| IUPAC Name | methyl 3-[(2S,3R,5R,7aS)-5-[(2R)-2-isocyanopropyl]-3-(trifluoromethylsulfonyloxymethyl)-3,3a,5,6,7,7a-hexahydro-2H-furo[3,2-b]pyran-2-yl]propaneperoxoate |
| SMILES | [C-]#[N+][C@H](C)C[C@H]1CC[C@@H]2O[C@@H](CCC(=O)OOC)[C@@H](COS(=O)(=O)C(F)(F)F)C2O1 |
| InChI | InChI=1S/C17H24F3NO8S/c1-10(21-2)8-11-4-5-14-16(27-11)12(9-26-30(23,24)17(18,19)20)13(28-14)6-7-15(22)29-25-3/h10-14,16H,4-9H2,1,3H3/t10-,11-,12-,13+,14+,16?/m1/s1 |
| InChIKey | ZDMQDHOIZHMWAM-IRVYOHAYSA-N |
| XLogP | 2.37 |
| TPSA | 101.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|