C16H23N3O4S2 — CID 88555899
(2S)-2-[[4-[[[(2R)-2-amino-3-sulfanylpropanoyl]amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid (PubChem CID 88555899) has the molecular formula C16H23N3O4S2 and a molecular weight of 385.51 g/mol. Its IUPAC name is (2S)-2-[[4-[[[(2R)-2-amino-3-sulfanylpropanoyl]amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid.
| Compound Name | (2S)-2-[[4-[[[(2R)-2-amino-3-sulfanylpropanoyl]amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
|---|---|
| PubChem CID | 88555899 |
| Molecular Formula | C16H23N3O4S2 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | (2S)-2-[[4-[[[(2R)-2-amino-3-sulfanylpropanoyl]amino]methyl]benzoyl]amino]-4-methylsulfanylbutanoic acid |
| SMILES | CSCC[C@H](NC(=O)c1ccc(CNC(=O)[C@@H](N)CS)cc1)C(=O)O |
| InChI | InChI=1S/C16H23N3O4S2/c1-25-7-6-13(16(22)23)19-14(20)11-4-2-10(3-5-11)8-18-15(21)12(17)9-24/h2-5,12-13,24H,6-9,17H2,1H3,(H,18,21)(H,19,20)(H,22,23)/t12-,13-/m0/s1 |
| InChIKey | QUVAHYQQABETQW-STQMWFEESA-N |
| XLogP | 0.50 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'misc_aminoacid_A(1)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|