About (4R)-4-hydroxy-3,5-dimethoxypentanal
(4R)-4-hydroxy-3,5-dimethoxypentanal (PubChem CID 88555944) has the molecular formula C7H14O4
and a molecular weight of 162.19 g/mol. Its IUPAC name is (4R)-4-hydroxy-3,5-dimethoxypentanal.
Molecular Properties
| Compound Name | (4R)-4-hydroxy-3,5-dimethoxypentanal |
| PubChem CID | 88555944 |
| Molecular Formula | C7H14O4 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (4R)-4-hydroxy-3,5-dimethoxypentanal |
| SMILES | COC[C@@H](O)C(CC=O)OC |
| InChI | InChI=1S/C7H14O4/c1-10-5-6(9)7(11-2)3-4-8/h4,6-7,9H,3,5H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | SFBPWIFTISUMSS-ULUSZKPHSA-N |
| XLogP | -0.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-hydroxy-3,5-dimethoxypentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-hydroxy-3,5-dimethoxypentanal?
The IUPAC name of (4R)-4-hydroxy-3,5-dimethoxypentanal (CID 88555944) is (4R)-4-hydroxy-3,5-dimethoxypentanal.
What is the SMILES notation for (4R)-4-hydroxy-3,5-dimethoxypentanal?
The canonical SMILES for (4R)-4-hydroxy-3,5-dimethoxypentanal is COC[C@@H](O)C(CC=O)OC.
What is the InChIKey of (4R)-4-hydroxy-3,5-dimethoxypentanal?
The InChIKey is SFBPWIFTISUMSS-ULUSZKPHSA-N. The full InChI is InChI=1S/C7H14O4/c1-10-5-6(9)7(11-2)3-4-8/h4,6-7,9H,3,5H2,1-2H3/t6-,7?/m1/s1.
What are the key properties of (4R)-4-hydroxy-3,5-dimethoxypentanal?
(4R)-4-hydroxy-3,5-dimethoxypentanal has a molecular weight of 162.19 g/mol, XLogP of -0.40, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-hydroxy-3,5-dimethoxypentanal is sourced from PubChem (CID 88555944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).