C32H50N2 — CID 88556051
1-N,2-N,4,5-tetramethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine (PubChem CID 88556051) has the molecular formula C32H50N2 and a molecular weight of 462.77 g/mol. Its IUPAC name is 1-N,2-N,4,5-tetramethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 1-N,2-N,4,5-tetramethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 88556051 |
| Molecular Formula | C32H50N2 |
| Molecular Weight | 462.77 g/mol |
| Exact Mass | 462.40 |
| IUPAC Name | 1-N,2-N,4,5-tetramethyl-3,6-bis[(2E,4E)-5,6,6-trimethylocta-2,4-dien-2-yl]cyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCC(C)(C)/C(C)=C/C=C(\C)C1=C(C)C(C)=C(/C(C)=C/C=C(\C)C(C)(C)CC)C(=N/C)/C1=N\C |
| InChI | InChI=1S/C32H50N2/c1-15-31(9,10)23(5)19-17-21(3)27-25(7)26(8)28(30(34-14)29(27)33-13)22(4)18-20-24(6)32(11,12)16-2/h17-20H,15-16H2,1-14H3/b21-17+,22-18+,23-19+,24-20+,33-29-,34-30- |
| InChIKey | VGLLBFPLHPFGHO-FGGLVKNTSA-N |
| XLogP | 9.43 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.77 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|