C15H22F6 — CID 88556055
(2Z,4Z)-11,11,11-trifluoro-3,6,10-trimethyl-8-(trifluoromethyl)undeca-2,4-diene (PubChem CID 88556055) has the molecular formula C15H22F6 and a molecular weight of 316.33 g/mol. Its IUPAC name is (2Z,4Z)-11,11,11-trifluoro-3,6,10-trimethyl-8-(trifluoromethyl)undeca-2,4-diene.
| Compound Name | (2Z,4Z)-11,11,11-trifluoro-3,6,10-trimethyl-8-(trifluoromethyl)undeca-2,4-diene |
|---|---|
| PubChem CID | 88556055 |
| Molecular Formula | C15H22F6 |
| Molecular Weight | 316.33 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | (2Z,4Z)-11,11,11-trifluoro-3,6,10-trimethyl-8-(trifluoromethyl)undeca-2,4-diene |
| SMILES | C/C=C(C)\C=C/C(C)CC(CC(C)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C15H22F6/c1-5-10(2)6-7-11(3)8-13(15(19,20)21)9-12(4)14(16,17)18/h5-7,11-13H,8-9H2,1-4H3/b7-6-,10-5- |
| InChIKey | AACRIOJDXFMNHB-BHHIIOOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.33 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|