C52H37N5 — CID 88556449
(1E,3Z)-5-phenyl-2-[3-[2-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]pyrimidin-4-yl]phenyl]hexa-1,3,5-trien-1-amine (PubChem CID 88556449) has the molecular formula C52H37N5 and a molecular weight of 731.90 g/mol. Its IUPAC name is (1E,3Z)-5-phenyl-2-[3-[2-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]pyrimidin-4-yl]phenyl]hexa-1,3,5-trien-1-amine.
| Compound Name | (1E,3Z)-5-phenyl-2-[3-[2-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]pyrimidin-4-yl]phenyl]hexa-1,3,5-trien-1-amine |
|---|---|
| PubChem CID | 88556449 |
| Molecular Formula | C52H37N5 |
| Molecular Weight | 731.90 g/mol |
| Exact Mass | 731.30 |
| IUPAC Name | (1E,3Z)-5-phenyl-2-[3-[2-[3-(9-phenylcarbazol-3-yl)carbazol-9-yl]pyrimidin-4-yl]phenyl]hexa-1,3,5-trien-1-amine |
| SMILES | C=C(/C=C\C(=C/N)c1cccc(-c2ccnc(-n3c4ccccc4c4cc(-c5ccc6c(c5)c5ccccc5n6-c5ccccc5)ccc43)n2)c1)c1ccccc1 |
| InChI | InChI=1S/C52H37N5/c1-35(36-13-4-2-5-14-36)23-24-41(34-53)37-15-12-16-40(31-37)47-29-30-54-52(55-47)57-49-22-11-9-20-44(49)46-33-39(26-28-51(46)57)38-25-27-50-45(32-38)43-19-8-10-21-48(43)56(50)42-17-6-3-7-18-42/h2-34H,1,53H2/b24-23-,41-34+ |
| InChIKey | CLWGTPPBDANHMM-XDHBZISRSA-N |
| XLogP | 12.57 |
| TPSA | 61.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.90 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|