C53H38N4S — CID 88556471
3-(9-phenylcarbazol-3-yl)-N'-[(1Z)-3-(8-phenyldibenzothiophen-4-yl)buta-1,3-dienyl]-2,3-dihydrocarbazole-9-carboximidamide (PubChem CID 88556471) has the molecular formula C53H38N4S and a molecular weight of 762.98 g/mol. Its IUPAC name is 3-(9-phenylcarbazol-3-yl)-N'-[(1Z)-3-(8-phenyldibenzothiophen-4-yl)buta-1,3-dienyl]-2,3-dihydrocarbazole-9-carboximidamide.
| Compound Name | 3-(9-phenylcarbazol-3-yl)-N'-[(1Z)-3-(8-phenyldibenzothiophen-4-yl)buta-1,3-dienyl]-2,3-dihydrocarbazole-9-carboximidamide |
|---|---|
| PubChem CID | 88556471 |
| Molecular Formula | C53H38N4S |
| Molecular Weight | 762.98 g/mol |
| Exact Mass | 762.28 |
| IUPAC Name | 3-(9-phenylcarbazol-3-yl)-N'-[(1Z)-3-(8-phenyldibenzothiophen-4-yl)buta-1,3-dienyl]-2,3-dihydrocarbazole-9-carboximidamide |
| SMILES | C=C(/C=C\N=C(/N)n1c2c(c3ccccc31)=CC(c1ccc3c(c1)c1ccccc1n3-c1ccccc1)CC=2)c1cccc2c1sc1ccc(-c3ccccc3)cc12 |
| InChI | InChI=1S/C53H38N4S/c1-34(40-19-12-20-43-46-33-36(35-13-4-2-5-14-35)25-28-51(46)58-52(40)43)29-30-55-53(54)57-48-22-11-9-18-42(48)45-32-38(24-27-50(45)57)37-23-26-49-44(31-37)41-17-8-10-21-47(41)56(49)39-15-6-3-7-16-39/h2-23,25-33,38H,1,24H2,(H2,54,55)/b30-29- |
| InChIKey | PBWNJIPQNZTPIR-FLWNBWAVSA-N |
| XLogP | 11.91 |
| TPSA | 48.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 762.98 |
| LogP ≤ 5 | 11.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|