C50H37N3O2 — CID 88556599
5-[4-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)quinazolin-2-yl]-2-dibenzofuran-4-yl-3,4,7b,11a-tetrahydro-[1]benzofuro[3,2-c]carbazole (PubChem CID 88556599) has the molecular formula C50H37N3O2 and a molecular weight of 711.87 g/mol. Its IUPAC name is 5-[4-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)quinazolin-2-yl]-2-dibenzofuran-4-yl-3,4,7b,11a-tetrahydro-[1]benzofuro[3,2-c]carbazole.
| Compound Name | 5-[4-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)quinazolin-2-yl]-2-dibenzofuran-4-yl-3,4,7b,11a-tetrahydro-[1]benzofuro[3,2-c]carbazole |
|---|---|
| PubChem CID | 88556599 |
| Molecular Formula | C50H37N3O2 |
| Molecular Weight | 711.87 g/mol |
| Exact Mass | 711.29 |
| IUPAC Name | 5-[4-(4-cyclohexa-1,3-dien-1-ylcyclohexa-1,3-dien-1-yl)quinazolin-2-yl]-2-dibenzofuran-4-yl-3,4,7b,11a-tetrahydro-[1]benzofuro[3,2-c]carbazole |
| SMILES | C1=CCCC(C2=CC=C(c3nc(-n4c5c(c6c7c(ccc64)C4C=CC=CC4O7)C=C(c4cccc6c4oc4ccccc46)CC5)nc4ccccc34)CC2)=C1 |
| InChI | InChI=1S/C50H37N3O2/c1-2-11-30(12-3-1)31-21-23-32(24-22-31)47-39-15-4-7-18-41(39)51-50(52-47)53-42-27-25-33(34-16-10-17-37-35-13-5-8-19-44(35)54-48(34)37)29-40(42)46-43(53)28-26-38-36-14-6-9-20-45(36)55-49(38)46/h1-2,4-11,13-21,23,26,28-29,36,45H,3,12,22,24-25,27H2 |
| InChIKey | CAZAHAWKEPNYEY-UHFFFAOYSA-N |
| XLogP | 12.31 |
| TPSA | 53.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.87 |
| LogP ≤ 5 | 12.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |