C25H39N — CID 88556662
(3E,8Z)-8-ethylidene-N-[(6E,9Z)-undeca-1,6,9-trien-6-yl]dodeca-1,3,11-trien-3-amine (PubChem CID 88556662) has the molecular formula C25H39N and a molecular weight of 353.59 g/mol. Its IUPAC name is (3E,8Z)-8-ethylidene-N-[(6E,9Z)-undeca-1,6,9-trien-6-yl]dodeca-1,3,11-trien-3-amine.
| Compound Name | (3E,8Z)-8-ethylidene-N-[(6E,9Z)-undeca-1,6,9-trien-6-yl]dodeca-1,3,11-trien-3-amine |
|---|---|
| PubChem CID | 88556662 |
| Molecular Formula | C25H39N |
| Molecular Weight | 353.59 g/mol |
| Exact Mass | 353.31 |
| IUPAC Name | (3E,8Z)-8-ethylidene-N-[(6E,9Z)-undeca-1,6,9-trien-6-yl]dodeca-1,3,11-trien-3-amine |
| SMILES | C=CCCC/C(=C\C/C=C\C)N/C(C=C)=C/CCC/C(=C/C)CCC=C |
| InChI | InChI=1S/C25H39N/c1-6-11-14-21-25(22-15-12-7-2)26-24(10-5)20-17-16-19-23(9-4)18-13-8-3/h6-10,12,20,22,26H,1,3,5,11,13-19,21H2,2,4H3/b12-7-,23-9+,24-20+,25-22+ |
| InChIKey | NRPARZYRKONCQV-DHSLUSRPSA-N |
| XLogP | 7.94 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.59 |
| LogP ≤ 5 | 7.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|