C41H68N2 — CID 88556771
3-[(E,4E)-4-(3,3-dimethylbutan-2-ylidene)dec-2-en-2-yl]-6-[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine (PubChem CID 88556771) has the molecular formula C41H68N2 and a molecular weight of 589.01 g/mol. Its IUPAC name is 3-[(E,4E)-4-(3,3-dimethylbutan-2-ylidene)dec-2-en-2-yl]-6-[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine.
| Compound Name | 3-[(E,4E)-4-(3,3-dimethylbutan-2-ylidene)dec-2-en-2-yl]-6-[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine |
|---|---|
| PubChem CID | 88556771 |
| Molecular Formula | C41H68N2 |
| Molecular Weight | 589.01 g/mol |
| Exact Mass | 588.54 |
| IUPAC Name | 3-[(E,4E)-4-(3,3-dimethylbutan-2-ylidene)dec-2-en-2-yl]-6-[(E,4E)-4-(3,3-dimethylpentan-2-ylidene)dec-2-en-2-yl]-1-N,2-N-dimethylcyclohexa-3,5-diene-1,2-diimine |
| SMILES | CCCCCCC(/C=C(\C)C1=CC=C(/C(C)=C/C(CCCCCC)=C(\C)C(C)(C)CC)C(=N/C)/C1=N/C)=C(/C)C(C)(C)C |
| InChI | InChI=1S/C41H68N2/c1-15-18-20-22-24-34(32(6)40(8,9)10)28-30(4)36-26-27-37(39(43-14)38(36)42-13)31(5)29-35(25-23-21-19-16-2)33(7)41(11,12)17-3/h26-29H,15-25H2,1-14H3/b30-28+,31-29+,34-32+,35-33+,42-38+,43-39- |
| InChIKey | PJGZBPKQCKUBAK-NHQFYSGUSA-N |
| XLogP | 12.94 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.01 |
| LogP ≤ 5 | 12.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|