About 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine
2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine (PubChem CID 88556887) has the molecular formula C8H17N3O
and a molecular weight of 171.24 g/mol. Its IUPAC name is 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine.
Molecular Properties
| Compound Name | 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine |
| PubChem CID | 88556887 |
| Molecular Formula | C8H17N3O |
| Molecular Weight | 171.24 g/mol |
| Exact Mass | 171.14 |
| IUPAC Name | 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine |
| SMILES | CC(C)C(=O)[C@@H](C)CN=C(N)N |
| InChI | InChI=1S/C8H17N3O/c1-5(2)7(12)6(3)4-11-8(9)10/h5-6H,4H2,1-3H3,(H4,9,10,11)/t6-/m0/s1 |
| InChIKey | HQXOIGZZMYQVGF-LURJTMIESA-N |
| XLogP | 0.12 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.24 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine?
The IUPAC name of 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine (CID 88556887) is 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine.
What is the SMILES notation for 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine?
The canonical SMILES for 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine is CC(C)C(=O)[C@@H](C)CN=C(N)N.
What is the InChIKey of 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine?
The InChIKey is HQXOIGZZMYQVGF-LURJTMIESA-N. The full InChI is InChI=1S/C8H17N3O/c1-5(2)7(12)6(3)4-11-8(9)10/h5-6H,4H2,1-3H3,(H4,9,10,11)/t6-/m0/s1.
What are the key properties of 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine?
2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine has a molecular weight of 171.24 g/mol, XLogP of 0.12, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2S)-2,4-dimethyl-3-oxopentyl]guanidine is sourced from PubChem (CID 88556887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).