C19H32O4 — CID 88557343
[(2E,6E)-8-methoxy-3,7,11,11-tetramethyl-10-oxododeca-2,6-dienyl] acetate (PubChem CID 88557343) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is [(2E,6E)-8-methoxy-3,7,11,11-tetramethyl-10-oxododeca-2,6-dienyl] acetate.
| Compound Name | [(2E,6E)-8-methoxy-3,7,11,11-tetramethyl-10-oxododeca-2,6-dienyl] acetate |
|---|---|
| PubChem CID | 88557343 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | [(2E,6E)-8-methoxy-3,7,11,11-tetramethyl-10-oxododeca-2,6-dienyl] acetate |
| SMILES | COC(CC(=O)C(C)(C)C)/C(C)=C/CC/C(C)=C/COC(C)=O |
| InChI | InChI=1S/C19H32O4/c1-14(11-12-23-16(3)20)9-8-10-15(2)17(22-7)13-18(21)19(4,5)6/h10-11,17H,8-9,12-13H2,1-7H3/b14-11+,15-10+ |
| InChIKey | ICNPICLKUZISAL-QYFSLLALSA-N |
| XLogP | 4.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|