About 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one
3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one (PubChem CID 88557373) has the molecular formula C8H6N2O3
and a molecular weight of 178.15 g/mol. Its IUPAC name is 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one |
| PubChem CID | 88557373 |
| Molecular Formula | C8H6N2O3 |
| Molecular Weight | 178.15 g/mol |
| Exact Mass | 178.04 |
| IUPAC Name | 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one |
| SMILES | O=Nc1cccc2c1C(O)NC2=O |
| InChI | InChI=1S/C8H6N2O3/c11-7-4-2-1-3-5(10-13)6(4)8(12)9-7/h1-3,8,12H,(H,9,11) |
| InChIKey | POWIMBMTHVTBOS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one?
The IUPAC name of 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one (CID 88557373) is 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one.
What is the SMILES notation for 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one?
The canonical SMILES for 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one is O=Nc1cccc2c1C(O)NC2=O.
What is the InChIKey of 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one?
The InChIKey is POWIMBMTHVTBOS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6N2O3/c11-7-4-2-1-3-5(10-13)6(4)8(12)9-7/h1-3,8,12H,(H,9,11).
What are the key properties of 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one?
3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one has a molecular weight of 178.15 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-4-nitroso-2,3-dihydroisoindol-1-one is sourced from PubChem (CID 88557373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).