C53H46S — CID 88557536
4-[3-[3-(3,14-ditert-butyl-19,19-dimethyl-8-pentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6(11),7,9,12(17),13,15-nonaenyl)phenyl]phenyl]dibenzothiophene (PubChem CID 88557536) has the molecular formula C53H46S and a molecular weight of 715.02 g/mol. Its IUPAC name is 4-[3-[3-(3,14-ditert-butyl-19,19-dimethyl-8-pentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6(11),7,9,12(17),13,15-nonaenyl)phenyl]phenyl]dibenzothiophene.
| Compound Name | 4-[3-[3-(3,14-ditert-butyl-19,19-dimethyl-8-pentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6(11),7,9,12(17),13,15-nonaenyl)phenyl]phenyl]dibenzothiophene |
|---|---|
| PubChem CID | 88557536 |
| Molecular Formula | C53H46S |
| Molecular Weight | 715.02 g/mol |
| Exact Mass | 714.33 |
| IUPAC Name | 4-[3-[3-(3,14-ditert-butyl-19,19-dimethyl-8-pentacyclo[14.2.1.05,18.06,11.012,17]nonadeca-1,3,5(18),6(11),7,9,12(17),13,15-nonaenyl)phenyl]phenyl]dibenzothiophene |
| SMILES | CC(C)(C)c1cc2c3c(c1)c1ccc(-c4cccc(-c5cccc(-c6cccc7c6sc6ccccc67)c5)c4)cc1c1cc(C(C)(C)C)cc(c13)C2(C)C |
| InChI | InChI=1S/C53H46S/c1-51(2,3)36-27-43-39-23-22-34(26-42(39)44-28-37(52(4,5)6)30-46-49(44)48(43)45(29-36)53(46,7)8)32-15-11-14-31(24-32)33-16-12-17-35(25-33)38-19-13-20-41-40-18-9-10-21-47(40)54-50(38)41/h9-30H,1-8H3 |
| InChIKey | QVPXCJRTJPKJJG-UHFFFAOYSA-N |
| XLogP | 15.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 715.02 |
| LogP ≤ 5 | 15.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|