C15H22F10O2 — CID 88557571
2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylpentan-3-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane (PubChem CID 88557571) has the molecular formula C15H22F10O2 and a molecular weight of 424.32 g/mol. Its IUPAC name is 2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylpentan-3-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane.
| Compound Name | 2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylpentan-3-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane |
|---|---|
| PubChem CID | 88557571 |
| Molecular Formula | C15H22F10O2 |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[difluoro-(1,1,1,2-tetrafluoro-2,3-dimethylpentan-3-yl)oxymethyl]-1,1,1,2-tetrafluoro-3-methoxy-3-methylpentane |
| SMILES | CCC(C)(OC(F)(F)C(F)(C(F)(F)F)C(C)(CC)OC)C(C)(F)C(F)(F)F |
| InChI | InChI=1S/C15H22F10O2/c1-7-9(3,11(5,16)13(18,19)20)27-15(24,25)12(17,14(21,22)23)10(4,8-2)26-6/h7-8H2,1-6H3 |
| InChIKey | JZAPJQPDOFPTIL-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |