C59H106O4 — CID 88557637
[(6Z,9Z,32Z)-18,24-dioxohentetraconta-6,9,32-trien-21-yl] (Z)-octadec-9-enoate (PubChem CID 88557637) has the molecular formula C59H106O4 and a molecular weight of 879.49 g/mol. Its IUPAC name is [(6Z,9Z,32Z)-18,24-dioxohentetraconta-6,9,32-trien-21-yl] (Z)-octadec-9-enoate.
| Compound Name | [(6Z,9Z,32Z)-18,24-dioxohentetraconta-6,9,32-trien-21-yl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 88557637 |
| Molecular Formula | C59H106O4 |
| Molecular Weight | 879.49 g/mol |
| Exact Mass | 878.81 |
| IUPAC Name | [(6Z,9Z,32Z)-18,24-dioxohentetraconta-6,9,32-trien-21-yl] (Z)-octadec-9-enoate |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)CCC(CCC(=O)CCCCCCC/C=C\CCCCCCCC)OC(=O)CCCCCCC/C=C\CCCCCCCC |
| InChI | InChI=1S/C59H106O4/c1-4-7-10-13-16-19-22-25-28-31-34-37-40-43-46-49-56(60)52-54-58(63-59(62)51-48-45-42-39-36-33-30-27-24-21-18-15-12-9-6-3)55-53-57(61)50-47-44-41-38-35-32-29-26-23-20-17-14-11-8-5-2/h16,19,25-30,58H,4-15,17-18,20-24,31-55H2,1-3H3/b19-16-,28-25-,29-26-,30-27- |
| InChIKey | KIADTRSHFLBZSH-KTKRTRQNSA-N |
| XLogP | 19.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 51 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 879.49 |
| LogP ≤ 5 | 19.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|