About 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide
2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide (PubChem CID 88557657) has the molecular formula C11H22N2O2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide |
| PubChem CID | 88557657 |
| Molecular Formula | C11H22N2O2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide |
| SMILES | CCC(C)(NC(=O)C(C)(C)C)C(=O)NC |
| InChI | InChI=1S/C11H22N2O2/c1-7-11(5,9(15)12-6)13-8(14)10(2,3)4/h7H2,1-6H3,(H,12,15)(H,13,14) |
| InChIKey | NTMAPIBNDURJGV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide?
The IUPAC name of 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide (CID 88557657) is 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide.
What is the SMILES notation for 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide?
The canonical SMILES for 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide is CCC(C)(NC(=O)C(C)(C)C)C(=O)NC.
What is the InChIKey of 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide?
The InChIKey is NTMAPIBNDURJGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O2/c1-7-11(5,9(15)12-6)13-8(14)10(2,3)4/h7H2,1-6H3,(H,12,15)(H,13,14).
What are the key properties of 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide?
2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide has a molecular weight of 214.31 g/mol, XLogP of 1.06, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dimethylpropanoylamino)-N,2-dimethylbutanamide is sourced from PubChem (CID 88557657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).