C19H8F4O6 — CID 88557732
5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3-tetrafluoropropan-2-yl]-2-benzofuran-1,3-dione (PubChem CID 88557732) has the molecular formula C19H8F4O6 and a molecular weight of 408.26 g/mol. Its IUPAC name is 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3-tetrafluoropropan-2-yl]-2-benzofuran-1,3-dione.
| Compound Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3-tetrafluoropropan-2-yl]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 88557732 |
| Molecular Formula | C19H8F4O6 |
| Molecular Weight | 408.26 g/mol |
| Exact Mass | 408.03 |
| IUPAC Name | 5-[2-(1,3-dioxo-2-benzofuran-5-yl)-1,1,1,3-tetrafluoropropan-2-yl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C(CF)(c3ccc4c(c3)C(=O)OC4=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C19H8F4O6/c20-7-18(19(21,22)23,8-1-3-10-12(5-8)16(26)28-14(10)24)9-2-4-11-13(6-9)17(27)29-15(11)25/h1-6H,7H2 |
| InChIKey | JNMMMMWIMXIUSE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.26 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|