C28H32N4O2 — CID 88557805
5-[4-[2-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-prop-2-ynylamino]ethyl]piperazin-1-yl]quinolin-8-ol (PubChem CID 88557805) has the molecular formula C28H32N4O2 and a molecular weight of 456.59 g/mol. Its IUPAC name is 5-[4-[2-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-prop-2-ynylamino]ethyl]piperazin-1-yl]quinolin-8-ol.
| Compound Name | 5-[4-[2-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-prop-2-ynylamino]ethyl]piperazin-1-yl]quinolin-8-ol |
|---|---|
| PubChem CID | 88557805 |
| Molecular Formula | C28H32N4O2 |
| Molecular Weight | 456.59 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 5-[4-[2-[(5-hydroxy-1,2,3,4-tetrahydronaphthalen-2-yl)-prop-2-ynylamino]ethyl]piperazin-1-yl]quinolin-8-ol |
| SMILES | C#CCN(CCN1CCN(c2ccc(O)c3ncccc23)CC1)C1CCc2c(O)cccc2C1 |
| InChI | InChI=1S/C28H32N4O2/c1-2-13-31(22-8-9-23-21(20-22)5-3-7-26(23)33)17-14-30-15-18-32(19-16-30)25-10-11-27(34)28-24(25)6-4-12-29-28/h1,3-7,10-12,22,33-34H,8-9,13-20H2 |
| InChIKey | VZATZSDLSFXKHM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 63.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.59 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|