C8H12F6O2 — CID 88558524
3-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbutan-1-ol (PubChem CID 88558524) has the molecular formula C8H12F6O2 and a molecular weight of 254.17 g/mol. Its IUPAC name is 3-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbutan-1-ol.
| Compound Name | 3-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 88558524 |
| Molecular Formula | C8H12F6O2 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 254.07 |
| IUPAC Name | 3-(1,1,2,3,3,3-hexafluoropropoxy)-3-methylbutan-1-ol |
| SMILES | CC(C)(CCO)OC(F)(F)C(F)C(F)(F)F |
| InChI | InChI=1S/C8H12F6O2/c1-6(2,3-4-15)16-8(13,14)5(9)7(10,11)12/h5,15H,3-4H2,1-2H3 |
| InChIKey | FOPMHPCANKQXOB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |