C15H15N3O3S3 — CID 88558618
S-[4,6-bis(2-methylprop-2-enoylsulfanyl)-1,3,5-triazin-2-yl] 2-methylprop-2-enethioate (PubChem CID 88558618) has the molecular formula C15H15N3O3S3 and a molecular weight of 381.50 g/mol. Its IUPAC name is S-[4,6-bis(2-methylprop-2-enoylsulfanyl)-1,3,5-triazin-2-yl] 2-methylprop-2-enethioate.
| Compound Name | S-[4,6-bis(2-methylprop-2-enoylsulfanyl)-1,3,5-triazin-2-yl] 2-methylprop-2-enethioate |
|---|---|
| PubChem CID | 88558618 |
| Molecular Formula | C15H15N3O3S3 |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.03 |
| IUPAC Name | S-[4,6-bis(2-methylprop-2-enoylsulfanyl)-1,3,5-triazin-2-yl] 2-methylprop-2-enethioate |
| SMILES | C=C(C)C(=O)Sc1nc(SC(=O)C(=C)C)nc(SC(=O)C(=C)C)n1 |
| InChI | InChI=1S/C15H15N3O3S3/c1-7(2)10(19)22-13-16-14(23-11(20)8(3)4)18-15(17-13)24-12(21)9(5)6/h1,3,5H2,2,4,6H3 |
| InChIKey | QKMSKCNJKCYOIH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 89.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|