C16H22N2 — CID 88558712
(2E,4Z)-N-[(E)-[(2E)-2-ethenyl-5-methylhexa-2,4-dienylidene]amino]hepta-2,4,6-trien-3-amine (PubChem CID 88558712) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is (2E,4Z)-N-[(E)-[(2E)-2-ethenyl-5-methylhexa-2,4-dienylidene]amino]hepta-2,4,6-trien-3-amine.
| Compound Name | (2E,4Z)-N-[(E)-[(2E)-2-ethenyl-5-methylhexa-2,4-dienylidene]amino]hepta-2,4,6-trien-3-amine |
|---|---|
| PubChem CID | 88558712 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | (2E,4Z)-N-[(E)-[(2E)-2-ethenyl-5-methylhexa-2,4-dienylidene]amino]hepta-2,4,6-trien-3-amine |
| SMILES | C=C/C=C\C(=C/C)N/N=C/C(C=C)=C/C=C(C)C |
| InChI | InChI=1S/C16H22N2/c1-6-9-10-16(8-3)18-17-13-15(7-2)12-11-14(4)5/h6-13,18H,1-2H2,3-5H3/b10-9-,15-12+,16-8+,17-13+ |
| InChIKey | ZFFKDWCSCRITCU-YZINXRMJSA-N |
| XLogP | 4.29 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|