C21H22ClFN6O4 — CID 88558717
2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-N'-hydroxyethanimidamide (PubChem CID 88558717) has the molecular formula C21H22ClFN6O4 and a molecular weight of 476.90 g/mol. Its IUPAC name is 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-N'-hydroxyethanimidamide.
| Compound Name | 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-N'-hydroxyethanimidamide |
|---|---|
| PubChem CID | 88558717 |
| Molecular Formula | C21H22ClFN6O4 |
| Molecular Weight | 476.90 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | 2-[3-[(4-chlorophenyl)methyl]-4-(3-fluoro-4-propan-2-yloxyanilino)-2,6-dioxo-1,3,5-triazin-1-yl]-N'-hydroxyethanimidamide |
| SMILES | CC(C)Oc1ccc(Nc2nc(=O)n(C/C(N)=N/O)c(=O)n2Cc2ccc(Cl)cc2)cc1F |
| InChI | InChI=1S/C21H22ClFN6O4/c1-12(2)33-17-8-7-15(9-16(17)23)25-19-26-20(30)29(11-18(24)27-32)21(31)28(19)10-13-3-5-14(22)6-4-13/h3-9,12,32H,10-11H2,1-2H3,(H2,24,27)(H,25,26,30) |
| InChIKey | KTJDRLLYUPKISB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 136.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.90 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|